C24H32N4 — CID 101114161
(7S,14S)-5,12-dimethyl-7,14-diphenyl-1,4,8,11-tetrazacyclotetradeca-4,11-diene (PubChem CID 101114161) has the molecular formula C24H32N4 and a molecular weight of 376.55 g/mol. Its IUPAC name is (7S,14S)-5,12-dimethyl-7,14-diphenyl-1,4,8,11-tetrazacyclotetradeca-4,11-diene.
| Compound Name | (7S,14S)-5,12-dimethyl-7,14-diphenyl-1,4,8,11-tetrazacyclotetradeca-4,11-diene |
|---|---|
| PubChem CID | 101114161 |
| Molecular Formula | C24H32N4 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (7S,14S)-5,12-dimethyl-7,14-diphenyl-1,4,8,11-tetrazacyclotetradeca-4,11-diene |
| SMILES | C/C1=N/CCN[C@H](c2ccccc2)C/C(C)=N\CCN[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C24H32N4/c1-19-17-23(21-9-5-3-6-10-21)27-16-14-26-20(2)18-24(28-15-13-25-19)22-11-7-4-8-12-22/h3-12,23-24,27-28H,13-18H2,1-2H3/b25-19-,26-20-/t23-,24-/m0/s1 |
| InChIKey | FDMSEGADSJCNSD-IBRAQHNDSA-N |
| XLogP | 4.36 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |