C22H24N2O6S — CID 11259335
6-phenyl-4-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-5,6-dihydro-1H-pyrimidine-2-thione (PubChem CID 11259335) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is 6-phenyl-4-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-5,6-dihydro-1H-pyrimidine-2-thione.
| Compound Name | 6-phenyl-4-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-5,6-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 11259335 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 6-phenyl-4-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-5,6-dihydro-1H-pyrimidine-2-thione |
| SMILES | OC[C@H]1O[C@@H](Oc2ccc(C3=NC(=S)NC(c4ccccc4)C3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H24N2O6S/c25-11-17-18(26)19(27)20(28)21(30-17)29-14-8-6-13(7-9-14)16-10-15(23-22(31)24-16)12-4-2-1-3-5-12/h1-9,15,17-21,25-28H,10-11H2,(H,23,31)/t15?,17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | BPHDNWWZAVWBMQ-UZQFATADSA-N |
| XLogP | 0.67 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|