C31H30BF4N3 — CID 170458253
2,3-diphenyl-6-(2,4,6-trimethylphenyl)-1,2,3,5-tetrahydroimidazo[1,2-c]quinazolin-4-ium tetrafluoroborate (PubChem CID 170458253) has the molecular formula C31H30BF4N3 and a molecular weight of 531.41 g/mol. Its IUPAC name is 2,3-diphenyl-6-(2,4,6-trimethylphenyl)-1,2,3,5-tetrahydroimidazo[1,2-c]quinazolin-4-ium tetrafluoroborate.
| Compound Name | 2,3-diphenyl-6-(2,4,6-trimethylphenyl)-1,2,3,5-tetrahydroimidazo[1,2-c]quinazolin-4-ium tetrafluoroborate |
|---|---|
| PubChem CID | 170458253 |
| Molecular Formula | C31H30BF4N3 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 2,3-diphenyl-6-(2,4,6-trimethylphenyl)-1,2,3,5-tetrahydroimidazo[1,2-c]quinazolin-4-ium tetrafluoroborate |
| SMILES | Cc1cc(C)c(N2C[N+]3=C(NC(c4ccccc4)C3c3ccccc3)c3ccccc32)c(C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C31H29N3.BF4/c1-21-18-22(2)29(23(3)19-21)33-20-34-30(25-14-8-5-9-15-25)28(24-12-6-4-7-13-24)32-31(34)26-16-10-11-17-27(26)33;2-1(3,4)5/h4-19,28,30H,20H2,1-3H3;/q;-1/p+1 |
| InChIKey | UGTKVLMSSDGGHX-UHFFFAOYSA-O |
| XLogP | 7.87 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|