C28H30Cl2N2 — CID 90751934
2-[dichloro(phenyl)methyl]-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole (PubChem CID 90751934) has the molecular formula C28H30Cl2N2 and a molecular weight of 465.47 g/mol. Its IUPAC name is 2-[dichloro(phenyl)methyl]-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole.
| Compound Name | 2-[dichloro(phenyl)methyl]-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole |
|---|---|
| PubChem CID | 90751934 |
| Molecular Formula | C28H30Cl2N2 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-[dichloro(phenyl)methyl]-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)C2C(Cl)(Cl)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H30Cl2N2/c1-18-14-20(3)25(21(4)15-18)31-12-13-32(26-22(5)16-19(2)17-23(26)6)27(31)28(29,30)24-10-8-7-9-11-24/h7-17,27H,1-6H3 |
| InChIKey | DWVSMOJWLGJGJA-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|