C16H13Cl3N2 — CID 66876684
1,3-diphenyl-2-(trichloromethyl)-2H-imidazole (PubChem CID 66876684) has the molecular formula C16H13Cl3N2 and a molecular weight of 339.65 g/mol. Its IUPAC name is 1,3-diphenyl-2-(trichloromethyl)-2H-imidazole.
| Compound Name | 1,3-diphenyl-2-(trichloromethyl)-2H-imidazole |
|---|---|
| PubChem CID | 66876684 |
| Molecular Formula | C16H13Cl3N2 |
| Molecular Weight | 339.65 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 1,3-diphenyl-2-(trichloromethyl)-2H-imidazole |
| SMILES | ClC(Cl)(Cl)C1N(c2ccccc2)C=CN1c1ccccc1 |
| InChI | InChI=1S/C16H13Cl3N2/c17-16(18,19)15-20(13-7-3-1-4-8-13)11-12-21(15)14-9-5-2-6-10-14/h1-12,15H |
| InChIKey | WEIRZOIRPXEPRT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|