About 1-phenyl-2,3-dipropyl-2H-imidazole
1-phenyl-2,3-dipropyl-2H-imidazole (PubChem CID 69387421) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-phenyl-2,3-dipropyl-2H-imidazole.
Molecular Properties
| Compound Name | 1-phenyl-2,3-dipropyl-2H-imidazole |
| PubChem CID | 69387421 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-phenyl-2,3-dipropyl-2H-imidazole |
| SMILES | CCCC1N(CCC)C=CN1c1ccccc1 |
| InChI | InChI=1S/C15H22N2/c1-3-8-15-16(11-4-2)12-13-17(15)14-9-6-5-7-10-14/h5-7,9-10,12-13,15H,3-4,8,11H2,1-2H3 |
| InChIKey | ALHYXQRNSLUTOQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-2,3-dipropyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2,3-dipropyl-2H-imidazole?
The IUPAC name of 1-phenyl-2,3-dipropyl-2H-imidazole (CID 69387421) is 1-phenyl-2,3-dipropyl-2H-imidazole.
What is the SMILES notation for 1-phenyl-2,3-dipropyl-2H-imidazole?
The canonical SMILES for 1-phenyl-2,3-dipropyl-2H-imidazole is CCCC1N(CCC)C=CN1c1ccccc1.
What is the InChIKey of 1-phenyl-2,3-dipropyl-2H-imidazole?
The InChIKey is ALHYXQRNSLUTOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2/c1-3-8-15-16(11-4-2)12-13-17(15)14-9-6-5-7-10-14/h5-7,9-10,12-13,15H,3-4,8,11H2,1-2H3.
What are the key properties of 1-phenyl-2,3-dipropyl-2H-imidazole?
1-phenyl-2,3-dipropyl-2H-imidazole has a molecular weight of 230.35 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2,3-dipropyl-2H-imidazole is sourced from PubChem (CID 69387421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).