C21H26N2S — CID 71730840
1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole-2-thiol (PubChem CID 71730840) has the molecular formula C21H26N2S and a molecular weight of 338.52 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole-2-thiol.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole-2-thiol |
|---|---|
| PubChem CID | 71730840 |
| Molecular Formula | C21H26N2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole-2-thiol |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)C2S)c(C)c1 |
| InChI | InChI=1S/C21H26N2S/c1-13-9-15(3)19(16(4)10-13)22-7-8-23(21(22)24)20-17(5)11-14(2)12-18(20)6/h7-12,21,24H,1-6H3 |
| InChIKey | KVHAZRAZYMUVHL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|