C22H26N2S2 — CID 139169547
[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]methanedithiol (PubChem CID 139169547) has the molecular formula C22H26N2S2 and a molecular weight of 382.60 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]methanedithiol.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]methanedithiol |
|---|---|
| PubChem CID | 139169547 |
| Molecular Formula | C22H26N2S2 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]methanedithiol |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)C2=C(S)S)c(C)c1 |
| InChI | InChI=1S/C22H26N2S2/c1-13-9-15(3)19(16(4)10-13)23-7-8-24(21(23)22(25)26)20-17(5)11-14(2)12-18(20)6/h7-12,25-26H,1-6H3 |
| InChIKey | YCWOFHYIPMZVLJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|