C15H22N2O — CID 5255189
3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]propan-1-ol (PubChem CID 5255189) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]propan-1-ol.
| Compound Name | 3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 5255189 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]propan-1-ol |
| SMILES | Cc1cc(C)c(N2C=CN(CCCO)C2)c(C)c1 |
| InChI | InChI=1S/C15H22N2O/c1-12-9-13(2)15(14(3)10-12)17-7-6-16(11-17)5-4-8-18/h6-7,9-10,18H,4-5,8,11H2,1-3H3 |
| InChIKey | POEIRMBDCOCHQG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |