C20H33BrN2 — CID 173052661
1-octyl-3-(2,4,6-trimethylphenyl)-2H-imidazole;hydrobromide (PubChem CID 173052661) has the molecular formula C20H33BrN2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-octyl-3-(2,4,6-trimethylphenyl)-2H-imidazole;hydrobromide.
| Compound Name | 1-octyl-3-(2,4,6-trimethylphenyl)-2H-imidazole;hydrobromide |
|---|---|
| PubChem CID | 173052661 |
| Molecular Formula | C20H33BrN2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-octyl-3-(2,4,6-trimethylphenyl)-2H-imidazole;hydrobromide |
| SMILES | Br.CCCCCCCCN1C=CN(c2c(C)cc(C)cc2C)C1 |
| InChI | InChI=1S/C20H32N2.BrH/c1-5-6-7-8-9-10-11-21-12-13-22(16-21)20-18(3)14-17(2)15-19(20)4;/h12-15H,5-11,16H2,1-4H3;1H |
| InChIKey | JBYVPQLSACCMLG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|