C25H36N2O3Si — CID 91024187
triethoxy-[4-[[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]methyl]phenyl]silane (PubChem CID 91024187) has the molecular formula C25H36N2O3Si and a molecular weight of 440.66 g/mol. Its IUPAC name is triethoxy-[4-[[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]methyl]phenyl]silane.
| Compound Name | triethoxy-[4-[[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]methyl]phenyl]silane |
|---|---|
| PubChem CID | 91024187 |
| Molecular Formula | C25H36N2O3Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | triethoxy-[4-[[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]methyl]phenyl]silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(CN2C=CN(c3c(C)cc(C)cc3C)C2)cc1 |
| InChI | InChI=1S/C25H36N2O3Si/c1-7-28-31(29-8-2,30-9-3)24-12-10-23(11-13-24)18-26-14-15-27(19-26)25-21(5)16-20(4)17-22(25)6/h10-17H,7-9,18-19H2,1-6H3 |
| InChIKey | AFORBXPZGZKYKW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|