C14H23FO3Si — CID 146004982
triethoxy-(4-fluoro-3,5-dimethylphenyl)silane (PubChem CID 146004982) has the molecular formula C14H23FO3Si and a molecular weight of 286.42 g/mol. Its IUPAC name is triethoxy-(4-fluoro-3,5-dimethylphenyl)silane.
| Compound Name | triethoxy-(4-fluoro-3,5-dimethylphenyl)silane |
|---|---|
| PubChem CID | 146004982 |
| Molecular Formula | C14H23FO3Si |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | triethoxy-(4-fluoro-3,5-dimethylphenyl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C14H23FO3Si/c1-6-16-19(17-7-2,18-8-3)13-9-11(4)14(15)12(5)10-13/h9-10H,6-8H2,1-5H3 |
| InChIKey | DVNPWLPOPGKCJQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|