About triethoxy-(4-fluoro-3,5-dimethylphenyl)silane
triethoxy-(4-fluoro-3,5-dimethylphenyl)silane (PubChem CID 146004982) has the molecular formula C14H23FO3Si
and a molecular weight of 286.42 g/mol. Its IUPAC name is triethoxy-(4-fluoro-3,5-dimethylphenyl)silane.
Molecular Properties
| Compound Name | triethoxy-(4-fluoro-3,5-dimethylphenyl)silane |
| PubChem CID | 146004982 |
| Molecular Formula | C14H23FO3Si |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | triethoxy-(4-fluoro-3,5-dimethylphenyl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C14H23FO3Si/c1-6-16-19(17-7-2,18-8-3)13-9-11(4)14(15)12(5)10-13/h9-10H,6-8H2,1-5H3 |
| InChIKey | DVNPWLPOPGKCJQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy-(4-fluoro-3,5-dimethylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy-(4-fluoro-3,5-dimethylphenyl)silane?
The IUPAC name of triethoxy-(4-fluoro-3,5-dimethylphenyl)silane (CID 146004982) is triethoxy-(4-fluoro-3,5-dimethylphenyl)silane.
What is the SMILES notation for triethoxy-(4-fluoro-3,5-dimethylphenyl)silane?
The canonical SMILES for triethoxy-(4-fluoro-3,5-dimethylphenyl)silane is CCO[Si](OCC)(OCC)c1cc(C)c(F)c(C)c1.
What is the InChIKey of triethoxy-(4-fluoro-3,5-dimethylphenyl)silane?
The InChIKey is DVNPWLPOPGKCJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23FO3Si/c1-6-16-19(17-7-2,18-8-3)13-9-11(4)14(15)12(5)10-13/h9-10H,6-8H2,1-5H3.
What are the key properties of triethoxy-(4-fluoro-3,5-dimethylphenyl)silane?
triethoxy-(4-fluoro-3,5-dimethylphenyl)silane has a molecular weight of 286.42 g/mol, XLogP of 2.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy-(4-fluoro-3,5-dimethylphenyl)silane is sourced from PubChem (CID 146004982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).