C10H14F2O3Si — CID 90173742
(3,5-difluorophenyl)-ethoxy-dimethoxysilane (PubChem CID 90173742) has the molecular formula C10H14F2O3Si and a molecular weight of 248.30 g/mol. Its IUPAC name is (3,5-difluorophenyl)-ethoxy-dimethoxysilane.
| Compound Name | (3,5-difluorophenyl)-ethoxy-dimethoxysilane |
|---|---|
| PubChem CID | 90173742 |
| Molecular Formula | C10H14F2O3Si |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (3,5-difluorophenyl)-ethoxy-dimethoxysilane |
| SMILES | CCO[Si](OC)(OC)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H14F2O3Si/c1-4-15-16(13-2,14-3)10-6-8(11)5-9(12)7-10/h5-7H,4H2,1-3H3 |
| InChIKey | QBYNKDFVMOZUAX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|