About [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane
[4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane (PubChem CID 90171356) has the molecular formula C17H20F2O3Si
and a molecular weight of 338.43 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane.
Molecular Properties
| Compound Name | [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane |
| PubChem CID | 90171356 |
| Molecular Formula | C17H20F2O3Si |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane |
| SMILES | CCO[Si](OC)(OCC)c1ccc(-c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H20F2O3Si/c1-4-21-23(20-3,22-5-2)15-9-6-13(7-10-15)14-8-11-16(18)17(19)12-14/h6-12H,4-5H2,1-3H3 |
| InChIKey | FKXBLKSOXWTIGQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane?
The IUPAC name of [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane (CID 90171356) is [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane.
What is the SMILES notation for [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane?
The canonical SMILES for [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane is CCO[Si](OC)(OCC)c1ccc(-c2ccc(F)c(F)c2)cc1.
What is the InChIKey of [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane?
The InChIKey is FKXBLKSOXWTIGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F2O3Si/c1-4-21-23(20-3,22-5-2)15-9-6-13(7-10-15)14-8-11-16(18)17(19)12-14/h6-12H,4-5H2,1-3H3.
What are the key properties of [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane?
[4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane has a molecular weight of 338.43 g/mol, XLogP of 3.50, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-difluorophenyl)phenyl]-diethoxy-methoxysilane is sourced from PubChem (CID 90171356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).