C9H12F2O2Si — CID 90174636
(3,4-difluorophenyl)-dimethoxy-methylsilane (PubChem CID 90174636) has the molecular formula C9H12F2O2Si and a molecular weight of 218.28 g/mol. Its IUPAC name is (3,4-difluorophenyl)-dimethoxy-methylsilane.
| Compound Name | (3,4-difluorophenyl)-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 90174636 |
| Molecular Formula | C9H12F2O2Si |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (3,4-difluorophenyl)-dimethoxy-methylsilane |
| SMILES | CO[Si](C)(OC)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H12F2O2Si/c1-12-14(3,13-2)7-4-5-8(10)9(11)6-7/h4-6H,1-3H3 |
| InChIKey | GCVIWYZVFVKLFF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|