C12H20ClF2NOSi — CID 112548417
1-(3,4-difluorophenyl)-1-trimethylsilyloxypropan-2-amine;hydrochloride (PubChem CID 112548417) has the molecular formula C12H20ClF2NOSi and a molecular weight of 295.83 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-1-trimethylsilyloxypropan-2-amine;hydrochloride.
| Compound Name | 1-(3,4-difluorophenyl)-1-trimethylsilyloxypropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 112548417 |
| Molecular Formula | C12H20ClF2NOSi |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-1-trimethylsilyloxypropan-2-amine;hydrochloride |
| SMILES | CC(N)C(O[Si](C)(C)C)c1ccc(F)c(F)c1.Cl |
| InChI | InChI=1S/C12H19F2NOSi.ClH/c1-8(15)12(16-17(2,3)4)9-5-6-10(13)11(14)7-9;/h5-8,12H,15H2,1-4H3;1H |
| InChIKey | GYZOSMQYDCBELN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|