C11H13F2NOSi — CID 18463714
2-(3,4-difluorophenyl)-2-trimethylsilyloxyacetonitrile (PubChem CID 18463714) has the molecular formula C11H13F2NOSi and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-trimethylsilyloxyacetonitrile.
| Compound Name | 2-(3,4-difluorophenyl)-2-trimethylsilyloxyacetonitrile |
|---|---|
| PubChem CID | 18463714 |
| Molecular Formula | C11H13F2NOSi |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-trimethylsilyloxyacetonitrile |
| SMILES | C[Si](C)(C)OC(C#N)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H13F2NOSi/c1-16(2,3)15-11(7-14)8-4-5-9(12)10(13)6-8/h4-6,11H,1-3H3 |
| InChIKey | ZAXNXBJYTHDLNG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|