C11H15NO3Si — CID 134884261
2-(2,4-dihydroxyphenyl)-2-trimethylsilyloxyacetonitrile (PubChem CID 134884261) has the molecular formula C11H15NO3Si and a molecular weight of 237.33 g/mol. Its IUPAC name is 2-(2,4-dihydroxyphenyl)-2-trimethylsilyloxyacetonitrile.
| Compound Name | 2-(2,4-dihydroxyphenyl)-2-trimethylsilyloxyacetonitrile |
|---|---|
| PubChem CID | 134884261 |
| Molecular Formula | C11H15NO3Si |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-2-trimethylsilyloxyacetonitrile |
| SMILES | C[Si](C)(C)OC(C#N)c1ccc(O)cc1O |
| InChI | InChI=1S/C11H15NO3Si/c1-16(2,3)15-11(7-12)9-5-4-8(13)6-10(9)14/h4-6,11,13-14H,1-3H3 |
| InChIKey | NJMGUUJGKFOLDY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|