C14H14O4S2 — CID 23187827
4-[2-(2,4-dihydroxyphenyl)-1,2-bis(sulfanyl)ethyl]benzene-1,3-diol (PubChem CID 23187827) has the molecular formula C14H14O4S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-[2-(2,4-dihydroxyphenyl)-1,2-bis(sulfanyl)ethyl]benzene-1,3-diol.
| Compound Name | 4-[2-(2,4-dihydroxyphenyl)-1,2-bis(sulfanyl)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 23187827 |
| Molecular Formula | C14H14O4S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-[2-(2,4-dihydroxyphenyl)-1,2-bis(sulfanyl)ethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C(S)C(S)c2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C14H14O4S2/c15-7-1-3-9(11(17)5-7)13(19)14(20)10-4-2-8(16)6-12(10)18/h1-6,13-20H |
| InChIKey | NRWAXFVAMQNLNU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|