C14H14O5 — CID 144664585
4-[1-(2,4-dihydroxyphenyl)-2-hydroxyethyl]benzene-1,3-diol (PubChem CID 144664585) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-[1-(2,4-dihydroxyphenyl)-2-hydroxyethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(2,4-dihydroxyphenyl)-2-hydroxyethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 144664585 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-[1-(2,4-dihydroxyphenyl)-2-hydroxyethyl]benzene-1,3-diol |
| SMILES | OCC(c1ccc(O)cc1O)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H14O5/c15-7-12(10-3-1-8(16)5-13(10)18)11-4-2-9(17)6-14(11)19/h1-6,12,15-19H,7H2 |
| InChIKey | FZLJAGPYRNXXJC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |