C23H24O6 — CID 150895447
4-[3,5-bis(2,4-dihydroxyphenyl)pentyl]benzene-1,3-diol (PubChem CID 150895447) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is 4-[3,5-bis(2,4-dihydroxyphenyl)pentyl]benzene-1,3-diol.
| Compound Name | 4-[3,5-bis(2,4-dihydroxyphenyl)pentyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 150895447 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-[3,5-bis(2,4-dihydroxyphenyl)pentyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CCC(CCc2ccc(O)cc2O)c2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C23H24O6/c24-17-7-5-15(21(27)11-17)3-1-14(20-10-9-19(26)13-23(20)29)2-4-16-6-8-18(25)12-22(16)28/h5-14,24-29H,1-4H2 |
| InChIKey | KYWXSADIQONVBH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |