About 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile
2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile (PubChem CID 158704674) has the molecular formula C18H19Cl2NO2Si
and a molecular weight of 380.35 g/mol. Its IUPAC name is 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile.
Molecular Properties
| Compound Name | 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile |
| PubChem CID | 158704674 |
| Molecular Formula | C18H19Cl2NO2Si |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile |
| SMILES | C[Si](C)(C)O[C@H](C#N)c1ccccc1Cl.O=Cc1ccccc1Cl |
| InChI | InChI=1S/C11H14ClNOSi.C7H5ClO/c1-15(2,3)14-11(8-13)9-6-4-5-7-10(9)12;8-7-4-2-1-3-6(7)5-9/h4-7,11H,1-3H3;1-5H/t11-;/m1./s1 |
| InChIKey | IHYVIZUUNOUNAW-RFVHGSKJSA-N |
| XLogP | 5.91 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile?
The IUPAC name of 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile (CID 158704674) is 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile.
What is the SMILES notation for 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile?
The canonical SMILES for 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile is C[Si](C)(C)O[C@H](C#N)c1ccccc1Cl.O=Cc1ccccc1Cl.
What is the InChIKey of 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile?
The InChIKey is IHYVIZUUNOUNAW-RFVHGSKJSA-N. The full InChI is InChI=1S/C11H14ClNOSi.C7H5ClO/c1-15(2,3)14-11(8-13)9-6-4-5-7-10(9)12;8-7-4-2-1-3-6(7)5-9/h4-7,11H,1-3H3;1-5H/t11-;/m1./s1.
What are the key properties of 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile?
2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile has a molecular weight of 380.35 g/mol, XLogP of 5.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzaldehyde;(2S)-2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile is sourced from PubChem (CID 158704674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).