About 2-aminopropanoic acid;2-chlorobenzaldehyde;copper
2-aminopropanoic acid;2-chlorobenzaldehyde;copper (PubChem CID 175322684) has the molecular formula C10H12ClCuNO3
and a molecular weight of 293.21 g/mol. Its IUPAC name is 2-aminopropanoic acid;2-chlorobenzaldehyde;copper.
Molecular Properties
| Compound Name | 2-aminopropanoic acid;2-chlorobenzaldehyde;copper |
| PubChem CID | 175322684 |
| Molecular Formula | C10H12ClCuNO3 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 2-aminopropanoic acid;2-chlorobenzaldehyde;copper |
| SMILES | CC(N)C(=O)O.O=Cc1ccccc1Cl.[Cu] |
| InChI | InChI=1S/C7H5ClO.C3H7NO2.Cu/c8-7-4-2-1-3-6(7)5-9;1-2(4)3(5)6;/h1-5H;2H,4H2,1H3,(H,5,6); |
| InChIKey | OJDLCZCTXVDIQB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopropanoic acid;2-chlorobenzaldehyde;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropanoic acid;2-chlorobenzaldehyde;copper?
The IUPAC name of 2-aminopropanoic acid;2-chlorobenzaldehyde;copper (CID 175322684) is 2-aminopropanoic acid;2-chlorobenzaldehyde;copper.
What is the SMILES notation for 2-aminopropanoic acid;2-chlorobenzaldehyde;copper?
The canonical SMILES for 2-aminopropanoic acid;2-chlorobenzaldehyde;copper is CC(N)C(=O)O.O=Cc1ccccc1Cl.[Cu].
What is the InChIKey of 2-aminopropanoic acid;2-chlorobenzaldehyde;copper?
The InChIKey is OJDLCZCTXVDIQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO.C3H7NO2.Cu/c8-7-4-2-1-3-6(7)5-9;1-2(4)3(5)6;/h1-5H;2H,4H2,1H3,(H,5,6);.
What are the key properties of 2-aminopropanoic acid;2-chlorobenzaldehyde;copper?
2-aminopropanoic acid;2-chlorobenzaldehyde;copper has a molecular weight of 293.21 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanoic acid;2-chlorobenzaldehyde;copper is sourced from PubChem (CID 175322684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).