About 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile
2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile (PubChem CID 160870687) has the molecular formula C15H11Cl2NO2
and a molecular weight of 308.16 g/mol. Its IUPAC name is 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile.
Molecular Properties
| Compound Name | 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile |
| PubChem CID | 160870687 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile |
| SMILES | N#C[C@H](O)c1ccccc1Cl.O=Cc1ccccc1Cl |
| InChI | InChI=1S/C8H6ClNO.C7H5ClO/c9-7-4-2-1-3-6(7)8(11)5-10;8-7-4-2-1-3-6(7)5-9/h1-4,8,11H;1-5H/t8-;/m0./s1 |
| InChIKey | SLSGRIKXGDCLTB-QRPNPIFTSA-N |
| XLogP | 4.05 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile?
The IUPAC name of 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile (CID 160870687) is 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile.
What is the SMILES notation for 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile?
The canonical SMILES for 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile is N#C[C@H](O)c1ccccc1Cl.O=Cc1ccccc1Cl.
What is the InChIKey of 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile?
The InChIKey is SLSGRIKXGDCLTB-QRPNPIFTSA-N. The full InChI is InChI=1S/C8H6ClNO.C7H5ClO/c9-7-4-2-1-3-6(7)8(11)5-10;8-7-4-2-1-3-6(7)5-9/h1-4,8,11H;1-5H/t8-;/m0./s1.
What are the key properties of 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile?
2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile has a molecular weight of 308.16 g/mol, XLogP of 4.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzaldehyde;(2R)-2-(2-chlorophenyl)-2-hydroxyacetonitrile is sourced from PubChem (CID 160870687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).