About 2-chlorobenzaldehyde;2-nitrobenzonitrile
2-chlorobenzaldehyde;2-nitrobenzonitrile (PubChem CID 87358266) has the molecular formula C14H9ClN2O3
and a molecular weight of 288.69 g/mol. Its IUPAC name is 2-chlorobenzaldehyde;2-nitrobenzonitrile.
Molecular Properties
| Compound Name | 2-chlorobenzaldehyde;2-nitrobenzonitrile |
| PubChem CID | 87358266 |
| Molecular Formula | C14H9ClN2O3 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-chlorobenzaldehyde;2-nitrobenzonitrile |
| SMILES | N#Cc1ccccc1[N+](=O)[O-].O=Cc1ccccc1Cl |
| InChI | InChI=1S/C7H5ClO.C7H4N2O2/c8-7-4-2-1-3-6(7)5-9;8-5-6-3-1-2-4-7(6)9(10)11/h1-5H;1-4H |
| InChIKey | VOCVXPBRSBNRAH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobenzaldehyde;2-nitrobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzaldehyde;2-nitrobenzonitrile?
The IUPAC name of 2-chlorobenzaldehyde;2-nitrobenzonitrile (CID 87358266) is 2-chlorobenzaldehyde;2-nitrobenzonitrile.
What is the SMILES notation for 2-chlorobenzaldehyde;2-nitrobenzonitrile?
The canonical SMILES for 2-chlorobenzaldehyde;2-nitrobenzonitrile is N#Cc1ccccc1[N+](=O)[O-].O=Cc1ccccc1Cl.
What is the InChIKey of 2-chlorobenzaldehyde;2-nitrobenzonitrile?
The InChIKey is VOCVXPBRSBNRAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO.C7H4N2O2/c8-7-4-2-1-3-6(7)5-9;8-5-6-3-1-2-4-7(6)9(10)11/h1-5H;1-4H.
What are the key properties of 2-chlorobenzaldehyde;2-nitrobenzonitrile?
2-chlorobenzaldehyde;2-nitrobenzonitrile has a molecular weight of 288.69 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzaldehyde;2-nitrobenzonitrile is sourced from PubChem (CID 87358266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).