C14H21NO4Si — CID 14566879
2-(2,4,5-trimethoxyphenyl)-2-trimethylsilyloxyacetonitrile (PubChem CID 14566879) has the molecular formula C14H21NO4Si and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-(2,4,5-trimethoxyphenyl)-2-trimethylsilyloxyacetonitrile.
| Compound Name | 2-(2,4,5-trimethoxyphenyl)-2-trimethylsilyloxyacetonitrile |
|---|---|
| PubChem CID | 14566879 |
| Molecular Formula | C14H21NO4Si |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-(2,4,5-trimethoxyphenyl)-2-trimethylsilyloxyacetonitrile |
| SMILES | COc1cc(OC)c(C(C#N)O[Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C14H21NO4Si/c1-16-11-8-13(18-3)12(17-2)7-10(11)14(9-15)19-20(4,5)6/h7-8,14H,1-6H3 |
| InChIKey | NRFVWEYVMNYRRS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|