C17H27NO4Si — CID 11759533
2-[tert-butyl(dimethyl)silyl]oxy-2-(2,4,5-trimethoxyphenyl)acetonitrile (PubChem CID 11759533) has the molecular formula C17H27NO4Si and a molecular weight of 337.49 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-(2,4,5-trimethoxyphenyl)acetonitrile.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-(2,4,5-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 11759533 |
| Molecular Formula | C17H27NO4Si |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-(2,4,5-trimethoxyphenyl)acetonitrile |
| SMILES | COc1cc(OC)c(C(C#N)O[Si](C)(C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C17H27NO4Si/c1-17(2,3)23(7,8)22-16(11-18)12-9-14(20-5)15(21-6)10-13(12)19-4/h9-10,16H,1-8H3 |
| InChIKey | UBCOWCNBXYAYEB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|