C21H38N2O3Si2 — CID 10622163
2-[3-amino-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxyphenyl]-2-[tert-butyl(dimethyl)silyl]oxyacetonitrile (PubChem CID 10622163) has the molecular formula C21H38N2O3Si2 and a molecular weight of 422.72 g/mol. Its IUPAC name is 2-[3-amino-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxyphenyl]-2-[tert-butyl(dimethyl)silyl]oxyacetonitrile.
| Compound Name | 2-[3-amino-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxyphenyl]-2-[tert-butyl(dimethyl)silyl]oxyacetonitrile |
|---|---|
| PubChem CID | 10622163 |
| Molecular Formula | C21H38N2O3Si2 |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[3-amino-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxyphenyl]-2-[tert-butyl(dimethyl)silyl]oxyacetonitrile |
| SMILES | COc1cc(C(C#N)O[Si](C)(C)C(C)(C)C)cc(N)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38N2O3Si2/c1-20(2,3)27(8,9)25-18(14-22)15-12-16(23)19(17(13-15)24-7)26-28(10,11)21(4,5)6/h12-13,18H,23H2,1-11H3 |
| InChIKey | YNFLPDALLIDCHL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|