C15H23NO2Si — CID 11033169
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)acetonitrile (PubChem CID 11033169) has the molecular formula C15H23NO2Si and a molecular weight of 277.44 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)acetonitrile.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 11033169 |
| Molecular Formula | C15H23NO2Si |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)acetonitrile |
| SMILES | COc1ccc([C@H](C#N)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H23NO2Si/c1-15(2,3)19(5,6)18-14(11-16)12-7-9-13(17-4)10-8-12/h7-10,14H,1-6H3/t14-/m0/s1 |
| InChIKey | NMDFRPQKBBPRHB-AWEZNQCLSA-N |
| XLogP | 4.28 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|