C29H36N2O7Si — CID 10554749
2-[tert-butyl(dimethyl)silyl]oxy-2-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-methoxy-5-phenylmethoxyphenyl]acetonitrile (PubChem CID 10554749) has the molecular formula C29H36N2O7Si and a molecular weight of 552.70 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-methoxy-5-phenylmethoxyphenyl]acetonitrile.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-methoxy-5-phenylmethoxyphenyl]acetonitrile |
|---|---|
| PubChem CID | 10554749 |
| Molecular Formula | C29H36N2O7Si |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-methoxy-5-phenylmethoxyphenyl]acetonitrile |
| SMILES | COc1c(NC=C2C(=O)OC(C)(C)OC2=O)cc(C(C#N)O[Si](C)(C)C(C)(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H36N2O7Si/c1-28(2,3)39(7,8)38-24(16-30)20-14-22(31-17-21-26(32)36-29(4,5)37-27(21)33)25(34-6)23(15-20)35-18-19-12-10-9-11-13-19/h9-15,17,24,31H,18H2,1-8H3 |
| InChIKey | HSIAGJYNCSPZIA-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 116.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|