C21H22N2O8S — CID 168540878
4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2,5-dimethoxy-N-phenylbenzenesulfonamide (PubChem CID 168540878) has the molecular formula C21H22N2O8S and a molecular weight of 462.48 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2,5-dimethoxy-N-phenylbenzenesulfonamide.
| Compound Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2,5-dimethoxy-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 168540878 |
| Molecular Formula | C21H22N2O8S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2,5-dimethoxy-N-phenylbenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)Nc2ccccc2)c(OC)cc1NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C21H22N2O8S/c1-21(2)30-19(24)14(20(25)31-21)12-22-15-10-17(29-4)18(11-16(15)28-3)32(26,27)23-13-8-6-5-7-9-13/h5-12,22-23H,1-4H3 |
| InChIKey | NHAXNDHIHIRGKA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|