C20H20N2O7S — CID 168538831
3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 168538831) has the molecular formula C20H20N2O7S and a molecular weight of 432.45 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168538831 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(NC=C3C(=O)OC(C)(C)OC3=O)c2)cc1 |
| InChI | InChI=1S/C20H20N2O7S/c1-20(2)28-18(23)17(19(24)29-20)12-21-14-5-4-6-16(11-14)30(25,26)22-13-7-9-15(27-3)10-8-13/h4-12,21-22H,1-3H3 |
| InChIKey | SAPFIFLUIPMNFH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|