C15H16N2O5S — CID 168651398
N-[2,5-dimethoxy-4-(phenylsulfamoyl)phenyl]formamide (PubChem CID 168651398) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-(phenylsulfamoyl)phenyl]formamide.
| Compound Name | N-[2,5-dimethoxy-4-(phenylsulfamoyl)phenyl]formamide |
|---|---|
| PubChem CID | 168651398 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[2,5-dimethoxy-4-(phenylsulfamoyl)phenyl]formamide |
| SMILES | COc1cc(S(=O)(=O)Nc2ccccc2)c(OC)cc1NC=O |
| InChI | InChI=1S/C15H16N2O5S/c1-21-13-9-15(14(22-2)8-12(13)16-10-18)23(19,20)17-11-6-4-3-5-7-11/h3-10,17H,1-2H3,(H,16,18) |
| InChIKey | PPLDXVHSOJMAKY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|