C28H36ClIO5Si — CID 23631496
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-1-chloro-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethyl]cyclopent-2-en-1-one (PubChem CID 23631496) has the molecular formula C28H36ClIO5Si and a molecular weight of 643.03 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-1-chloro-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethyl]cyclopent-2-en-1-one.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-1-chloro-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 23631496 |
| Molecular Formula | C28H36ClIO5Si |
| Molecular Weight | 643.03 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-1-chloro-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethyl]cyclopent-2-en-1-one |
| SMILES | COc1c(OCc2ccccc2)cc(I)c(C[C@H](Cl)C2=CC(=O)C[C@@H]2O[Si](C)(C)C(C)(C)C)c1OC |
| InChI | InChI=1S/C28H36ClIO5Si/c1-28(2,3)36(6,7)35-24-14-19(31)13-20(24)22(29)15-21-23(30)16-25(27(33-5)26(21)32-4)34-17-18-11-9-8-10-12-18/h8-13,16,22,24H,14-15,17H2,1-7H3/t22-,24-/m0/s1 |
| InChIKey | GIOPMLJZHJVOON-UPVQGACJSA-N |
| XLogP | 7.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.03 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|