C34H53IO6Si2 — CID 23631495
(1R)-1-[(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxycyclopenten-1-yl]-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethanol (PubChem CID 23631495) has the molecular formula C34H53IO6Si2 and a molecular weight of 740.87 g/mol. Its IUPAC name is (1R)-1-[(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxycyclopenten-1-yl]-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethanol.
| Compound Name | (1R)-1-[(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxycyclopenten-1-yl]-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 23631495 |
| Molecular Formula | C34H53IO6Si2 |
| Molecular Weight | 740.87 g/mol |
| Exact Mass | 740.24 |
| IUPAC Name | (1R)-1-[(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxycyclopenten-1-yl]-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethanol |
| SMILES | CC[Si](CC)(CC)O[C@H]1C=C([C@H](O)Cc2c(I)cc(OCc3ccccc3)c(OC)c2OC)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C34H53IO6Si2/c1-11-43(12-2,13-3)40-25-19-27(30(20-25)41-42(9,10)34(4,5)6)29(36)21-26-28(35)22-31(33(38-8)32(26)37-7)39-23-24-17-15-14-16-18-24/h14-19,22,25,29-30,36H,11-13,20-21,23H2,1-10H3/t25-,29+,30-/m0/s1 |
| InChIKey | VOWDISOWCZNZPM-LQJQRVQGSA-N |
| XLogP | 8.90 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.87 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|