C34H46INO3Si — CID 66761634
(R)-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-propan-2-yl-6,8-dihydro-5H-quinolin-3-yl]-(4-phenylmethoxyphenyl)methanol (PubChem CID 66761634) has the molecular formula C34H46INO3Si and a molecular weight of 671.74 g/mol. Its IUPAC name is (R)-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-propan-2-yl-6,8-dihydro-5H-quinolin-3-yl]-(4-phenylmethoxyphenyl)methanol.
| Compound Name | (R)-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-propan-2-yl-6,8-dihydro-5H-quinolin-3-yl]-(4-phenylmethoxyphenyl)methanol |
|---|---|
| PubChem CID | 66761634 |
| Molecular Formula | C34H46INO3Si |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.23 |
| IUPAC Name | (R)-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-propan-2-yl-6,8-dihydro-5H-quinolin-3-yl]-(4-phenylmethoxyphenyl)methanol |
| SMILES | CC(C)c1nc2c(c(I)c1[C@H](O)c1ccc(OCc3ccccc3)cc1)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C34H46INO3Si/c1-22(2)31-29(32(37)24-15-17-25(18-16-24)38-21-23-13-11-10-12-14-23)30(35)28-26(36-31)19-34(6,7)20-27(28)39-40(8,9)33(3,4)5/h10-18,22,27,32,37H,19-21H2,1-9H3/t27-,32+/m0/s1 |
| InChIKey | UCEZFAWWMGJZPZ-QVWWMRLHSA-N |
| XLogP | 9.51 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|