C33H50INO2Si — CID 66762452
[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-4-iodo-7,7-dimethyl-6,8-dihydro-5H-quinolin-3-yl]-(4-tert-butylphenyl)methanol (PubChem CID 66762452) has the molecular formula C33H50INO2Si and a molecular weight of 647.76 g/mol. Its IUPAC name is [(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-4-iodo-7,7-dimethyl-6,8-dihydro-5H-quinolin-3-yl]-(4-tert-butylphenyl)methanol.
| Compound Name | [(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-4-iodo-7,7-dimethyl-6,8-dihydro-5H-quinolin-3-yl]-(4-tert-butylphenyl)methanol |
|---|---|
| PubChem CID | 66762452 |
| Molecular Formula | C33H50INO2Si |
| Molecular Weight | 647.76 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | [(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-4-iodo-7,7-dimethyl-6,8-dihydro-5H-quinolin-3-yl]-(4-tert-butylphenyl)methanol |
| SMILES | CC1(C)Cc2nc(C3CCCC3)c(C(O)c3ccc(C(C)(C)C)cc3)c(I)c2[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C33H50INO2Si/c1-31(2,3)23-17-15-22(16-18-23)30(36)27-28(34)26-24(35-29(27)21-13-11-12-14-21)19-33(7,8)20-25(26)37-38(9,10)32(4,5)6/h15-18,21,25,30,36H,11-14,19-20H2,1-10H3/t25-,30?/m0/s1 |
| InChIKey | UKXIUGXYZARLGX-SUHMBNCMSA-N |
| XLogP | 9.76 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.76 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|