C36H55NO2Si — CID 66762653
tert-butyl-[[(3R,9S)-3-(4-tert-butylphenyl)-4-cyclopentyl-1,1,7,7-tetramethyl-3,6,8,9-tetrahydrofuro[3,4-c]quinolin-9-yl]oxy]-dimethylsilane (PubChem CID 66762653) has the molecular formula C36H55NO2Si and a molecular weight of 561.93 g/mol. Its IUPAC name is tert-butyl-[[(3R,9S)-3-(4-tert-butylphenyl)-4-cyclopentyl-1,1,7,7-tetramethyl-3,6,8,9-tetrahydrofuro[3,4-c]quinolin-9-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(3R,9S)-3-(4-tert-butylphenyl)-4-cyclopentyl-1,1,7,7-tetramethyl-3,6,8,9-tetrahydrofuro[3,4-c]quinolin-9-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 66762653 |
| Molecular Formula | C36H55NO2Si |
| Molecular Weight | 561.93 g/mol |
| Exact Mass | 561.40 |
| IUPAC Name | tert-butyl-[[(3R,9S)-3-(4-tert-butylphenyl)-4-cyclopentyl-1,1,7,7-tetramethyl-3,6,8,9-tetrahydrofuro[3,4-c]quinolin-9-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)Cc2nc(C3CCCC3)c3c(c2[C@@H](O[Si](C)(C)C(C)(C)C)C1)C(C)(C)O[C@@H]3c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C36H55NO2Si/c1-33(2,3)25-19-17-24(18-20-25)32-29-30(36(9,10)38-32)28-26(37-31(29)23-15-13-14-16-23)21-35(7,8)22-27(28)39-40(11,12)34(4,5)6/h17-20,23,27,32H,13-16,21-22H2,1-12H3/t27-,32+/m0/s1 |
| InChIKey | KURLPUUTGQPCEB-QVWWMRLHSA-N |
| XLogP | 10.43 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.93 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|