C35H51F4NO3SSi — CID 123313870
tert-butyl-[7,7-dimethyl-4-(oxan-4-yl)-3-[4-[tetrafluoro(methyl)-λ6-sulfanyl]phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane (PubChem CID 123313870) has the molecular formula C35H51F4NO3SSi and a molecular weight of 669.94 g/mol. Its IUPAC name is tert-butyl-[7,7-dimethyl-4-(oxan-4-yl)-3-[4-[tetrafluoro(methyl)-λ6-sulfanyl]phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[7,7-dimethyl-4-(oxan-4-yl)-3-[4-[tetrafluoro(methyl)-λ6-sulfanyl]phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 123313870 |
| Molecular Formula | C35H51F4NO3SSi |
| Molecular Weight | 669.94 g/mol |
| Exact Mass | 669.33 |
| IUPAC Name | tert-butyl-[7,7-dimethyl-4-(oxan-4-yl)-3-[4-[tetrafluoro(methyl)-λ6-sulfanyl]phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
| SMILES | CC1(C)Cc2nc(C3CCOCC3)c3c(c2C(O[Si](C)(C)C(C)(C)C)C1)C1(CCCC1)OC3c1ccc(S(C)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C35H51F4NO3SSi/c1-33(2,3)45(7,8)43-27-22-34(4,5)21-26-28(27)30-29(31(40-26)23-15-19-41-20-16-23)32(42-35(30)17-9-10-18-35)24-11-13-25(14-12-24)44(6,36,37,38)39/h11-14,23,27,32H,9-10,15-22H2,1-8H3 |
| InChIKey | FLYCOQLPKYHIHL-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.94 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|