C40H61NO4Si — CID 123681622
tert-butyl-[3-(4-tert-butylphenyl)-3'-ethyl-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane (PubChem CID 123681622) has the molecular formula C40H61NO4Si and a molecular weight of 648.02 g/mol. Its IUPAC name is tert-butyl-[3-(4-tert-butylphenyl)-3'-ethyl-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[3-(4-tert-butylphenyl)-3'-ethyl-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 123681622 |
| Molecular Formula | C40H61NO4Si |
| Molecular Weight | 648.02 g/mol |
| Exact Mass | 647.44 |
| IUPAC Name | tert-butyl-[3-(4-tert-butylphenyl)-3'-ethyl-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
| SMILES | CCC1COCCC12OC(c1ccc(C(C)(C)C)cc1)c1c(C3CCOCC3)nc3c(c12)C(O[Si](C)(C)C(C)(C)C)CC(C)(C)C3 |
| InChI | InChI=1S/C40H61NO4Si/c1-12-28-25-43-22-19-40(28)34-32-30(23-39(8,9)24-31(32)45-46(10,11)38(5,6)7)41-35(26-17-20-42-21-18-26)33(34)36(44-40)27-13-15-29(16-14-27)37(2,3)4/h13-16,26,28,31,36H,12,17-25H2,1-11H3 |
| InChIKey | JINWAFDVYLPUGU-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.02 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|