C34H49F2NO2Si — CID 77228096
tert-butyl-[3-[4-(1,1-difluoroethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane (PubChem CID 77228096) has the molecular formula C34H49F2NO2Si and a molecular weight of 569.85 g/mol. Its IUPAC name is tert-butyl-[3-[4-(1,1-difluoroethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[3-[4-(1,1-difluoroethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 77228096 |
| Molecular Formula | C34H49F2NO2Si |
| Molecular Weight | 569.85 g/mol |
| Exact Mass | 569.35 |
| IUPAC Name | tert-butyl-[3-[4-(1,1-difluoroethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
| SMILES | CC(C)c1nc2c(c3c1C(c1ccc(C(C)(F)F)cc1)OC31CCCC1)C(O[Si](C)(C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C34H49F2NO2Si/c1-21(2)29-27-28(26-24(37-29)19-32(6,7)20-25(26)39-40(9,10)31(3,4)5)34(17-11-12-18-34)38-30(27)22-13-15-23(16-14-22)33(8,35)36/h13-16,21,25,30H,11-12,17-20H2,1-10H3 |
| InChIKey | QOAAJCREUZHPOA-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.85 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|