C34H46F3NO4Si — CID 78055510
CID 78055510 (PubChem CID 78055510) has the molecular formula C34H46F3NO4Si and a molecular weight of 617.83 g/mol.
| Compound Name | CID 78055510 |
|---|---|
| PubChem CID | 78055510 |
| Molecular Formula | C34H46F3NO4Si |
| Molecular Weight | 617.83 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | — |
| SMILES | COc1cc(C2OC3(CCOCC3)c3c4c(nc(C(C)C)c32)CC2(CC2)CC4O[Si](C)(C)C(C)(C)C)ccc1C(F)(F)F |
| InChI | InChI=1S/C34H46F3NO4Si/c1-20(2)29-27-28(26-23(38-29)18-32(11-12-32)19-25(26)42-43(7,8)31(3,4)5)33(13-15-40-16-14-33)41-30(27)21-9-10-22(34(35,36)37)24(17-21)39-6/h9-10,17,20,25,30H,11-16,18-19H2,1-8H3 |
| InChIKey | LCJRQQVLSDFPRJ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.83 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|