C32H45F3N2O3Si — CID 77228051
tert-butyl-[7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane (PubChem CID 77228051) has the molecular formula C32H45F3N2O3Si and a molecular weight of 590.80 g/mol. Its IUPAC name is tert-butyl-[7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 77228051 |
| Molecular Formula | C32H45F3N2O3Si |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | tert-butyl-[7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
| SMILES | CC(C)c1nc2c(c3c1C(c1ccc(C(F)(F)F)nc1)OC31CCOCC1)C(O[Si](C)(C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C32H45F3N2O3Si/c1-19(2)27-25-26(24-21(37-27)16-30(6,7)17-22(24)40-41(8,9)29(3,4)5)31(12-14-38-15-13-31)39-28(25)20-10-11-23(36-18-20)32(33,34)35/h10-11,18-19,22,28H,12-17H2,1-9H3 |
| InChIKey | VQTWMKZRIBELON-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|