C26H30F3IN2O2 — CID 162589470
(3R)-2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol (PubChem CID 162589470) has the molecular formula C26H30F3IN2O2 and a molecular weight of 586.44 g/mol. Its IUPAC name is (3R)-2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol.
| Compound Name | (3R)-2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 162589470 |
| Molecular Formula | C26H30F3IN2O2 |
| Molecular Weight | 586.44 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | (3R)-2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)nc1)OC31CCCC1I)C(O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H30F3IN2O2/c1-13(2)22-20-21(19-15(32-22)10-24(3,4)11-16(19)33)25(9-5-6-17(25)30)34-23(20)14-7-8-18(31-12-14)26(27,28)29/h7-8,12-13,16-17,23,33H,5-6,9-11H2,1-4H3/t16?,17?,23-,25?/m1/s1 |
| InChIKey | ZNQNWQHKMUAYSB-YJMDJCIMSA-N |
| XLogP | 6.93 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.44 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|