C27H31F3INO2 — CID 162589488
2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[3-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol (PubChem CID 162589488) has the molecular formula C27H31F3INO2 and a molecular weight of 585.45 g/mol. Its IUPAC name is 2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[3-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol.
| Compound Name | 2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[3-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 162589488 |
| Molecular Formula | C27H31F3INO2 |
| Molecular Weight | 585.45 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | 2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[3-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
| SMILES | CC(C)c1nc2c(c3c1C(c1cccc(C(F)(F)F)c1)OC31CCCC1I)C(O)CC(C)(C)C2 |
| InChI | InChI=1S/C27H31F3INO2/c1-14(2)23-21-22(20-17(32-23)12-25(3,4)13-18(20)33)26(10-6-9-19(26)31)34-24(21)15-7-5-8-16(11-15)27(28,29)30/h5,7-8,11,14,18-19,24,33H,6,9-10,12-13H2,1-4H3 |
| InChIKey | LOBLIAUVKVGNAN-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.45 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|