C31H44N2O2 — CID 123903222
3-(2-tert-butyl-4,5-dihydroazocin-7-yl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol (PubChem CID 123903222) has the molecular formula C31H44N2O2 and a molecular weight of 476.71 g/mol. Its IUPAC name is 3-(2-tert-butyl-4,5-dihydroazocin-7-yl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol.
| Compound Name | 3-(2-tert-butyl-4,5-dihydroazocin-7-yl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 123903222 |
| Molecular Formula | C31H44N2O2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | 3-(2-tert-butyl-4,5-dihydroazocin-7-yl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
| SMILES | CC(C)c1nc2c(c3c1C(C1=CCCC=C(C(C)(C)C)/N=C\1)OC31CCCC1)C(O)CC(C)(C)C2 |
| InChI | InChI=1S/C31H44N2O2/c1-19(2)27-25-26(24-21(33-27)16-30(6,7)17-22(24)34)31(14-10-11-15-31)35-28(25)20-12-8-9-13-23(32-18-20)29(3,4)5/h12-13,18-19,22,28,34H,8-11,14-17H2,1-7H3/b20-12?,23-13?,32-18- |
| InChIKey | OMAUXWOYBDHGDA-SWWPUOIHSA-N |
| XLogP | 7.77 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |