C30H41NO3 — CID 71134657
(3R)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6,9-diol (PubChem CID 71134657) has the molecular formula C30H41NO3 and a molecular weight of 463.66 g/mol. Its IUPAC name is (3R)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6,9-diol.
| Compound Name | (3R)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6,9-diol |
|---|---|
| PubChem CID | 71134657 |
| Molecular Formula | C30H41NO3 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | (3R)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6,9-diol |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(C)(C)C)cc1)OC31CCCC1)C(O)CC(C)(C)C2O |
| InChI | InChI=1S/C30H41NO3/c1-17(2)24-22-23(21-20(32)16-29(6,7)27(33)25(21)31-24)30(14-8-9-15-30)34-26(22)18-10-12-19(13-11-18)28(3,4)5/h10-13,17,20,26-27,32-33H,8-9,14-16H2,1-7H3/t20?,26-,27?/m1/s1 |
| InChIKey | QMTQVCGIWAKKPZ-KLYDTVHSSA-N |
| XLogP | 6.89 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |