C35H48F3NO4Si — CID 162560793
[(3R,6R)-9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl] acetate (PubChem CID 162560793) has the molecular formula C35H48F3NO4Si and a molecular weight of 631.85 g/mol. Its IUPAC name is [(3R,6R)-9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl] acetate.
| Compound Name | [(3R,6R)-9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl] acetate |
|---|---|
| PubChem CID | 162560793 |
| Molecular Formula | C35H48F3NO4Si |
| Molecular Weight | 631.85 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | [(3R,6R)-9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1c2nc(C(C)C)c3c(c2C(O[Si](C)(C)C(C)(C)C)CC1(C)C)C1(CCCC1)O[C@@H]3c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H48F3NO4Si/c1-20(2)28-26-27(34(17-11-12-18-34)42-30(26)22-13-15-23(16-14-22)35(36,37)38)25-24(43-44(9,10)32(4,5)6)19-33(7,8)31(29(25)39-28)41-21(3)40/h13-16,20,24,30-31H,11-12,17-19H2,1-10H3/t24?,30-,31+/m1/s1 |
| InChIKey | SUQMYXDMGFIDLQ-MRJHNURISA-N |
| XLogP | 10.21 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.85 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|