C29H32F4NO5- — CID 163796840
(3S,6S)-6-acetyloxy-3-[2-fluoro-4-(trifluoromethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-olate (PubChem CID 163796840) has the molecular formula C29H32F4NO5- and a molecular weight of 550.57 g/mol. Its IUPAC name is (3S,6S)-6-acetyloxy-3-[2-fluoro-4-(trifluoromethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-olate.
| Compound Name | (3S,6S)-6-acetyloxy-3-[2-fluoro-4-(trifluoromethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-olate |
|---|---|
| PubChem CID | 163796840 |
| Molecular Formula | C29H32F4NO5- |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | (3S,6S)-6-acetyloxy-3-[2-fluoro-4-(trifluoromethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-olate |
| SMILES | CC(=O)O[C@@H]1c2nc(C(C)C)c3c(c2C([O-])CC1(C)C)C1(CCOCC1)O[C@@H]3c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C29H32F4NO5/c1-14(2)23-21-22(20-19(36)13-27(4,5)26(24(20)34-23)38-15(3)35)28(8-10-37-11-9-28)39-25(21)17-7-6-16(12-18(17)30)29(31,32)33/h6-7,12,14,19,25-26H,8-11,13H2,1-5H3/q-1/t19?,25-,26-/m1/s1 |
| InChIKey | NBNRQLXJCJZOOL-VTFDQJKESA-N |
| XLogP | 5.92 |
| TPSA | 80.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |