C36H50F2N2O6Si — CID 123624278
[9-[tert-butyl(dimethyl)silyl]oxy-3-[6-(difluoromethyl)-3-pyridinyl]-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6-yl] acetate (PubChem CID 123624278) has the molecular formula C36H50F2N2O6Si and a molecular weight of 672.89 g/mol. Its IUPAC name is [9-[tert-butyl(dimethyl)silyl]oxy-3-[6-(difluoromethyl)-3-pyridinyl]-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6-yl] acetate.
| Compound Name | [9-[tert-butyl(dimethyl)silyl]oxy-3-[6-(difluoromethyl)-3-pyridinyl]-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6-yl] acetate |
|---|---|
| PubChem CID | 123624278 |
| Molecular Formula | C36H50F2N2O6Si |
| Molecular Weight | 672.89 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | [9-[tert-butyl(dimethyl)silyl]oxy-3-[6-(difluoromethyl)-3-pyridinyl]-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6-yl] acetate |
| SMILES | CC(=O)OC1c2nc(C3CCOCC3)c3c(c2C(O[Si](C)(C)C(C)(C)C)CC1(C)C)C1(CCOCC1)OC3c1ccc(C(F)F)nc1 |
| InChI | InChI=1S/C36H50F2N2O6Si/c1-21(41)44-32-30-26(25(19-35(32,5)6)46-47(7,8)34(2,3)4)28-27(29(40-30)22-11-15-42-16-12-22)31(45-36(28)13-17-43-18-14-36)23-9-10-24(33(37)38)39-20-23/h9-10,20,22,25,31-33H,11-19H2,1-8H3 |
| InChIKey | IMIRUSLGPFJUHL-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.89 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|